Products 1956328-28-1
CAS 1956328-28-1 is the registry number for 3-Phenylpiperidin-3-ol oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Oxalic acid;3-phenylpiperidin-3-ol (CAS 1956328-28-1) is a chemical compound with the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. IUPAC name: oxalic acid;3-phenylpiperidin-3-ol. InChIKey: CDFVAZSPMGRUBT-UHFFFAOYSA-N.
| Molecular formula | C13H17NO5 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | oxalic acid;3-phenylpiperidin-3-ol |
| InChIKey | CDFVAZSPMGRUBT-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)(C2=CC=CC=C2)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)