cas: 59695-29-3 — see every product listed under this CAS number, including other names
3-(4-Methylpiperazin-1-yl)propanoic acid dihydrochloride, 97%, 97% (CAS 59695-29-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11F0Q3-100mg |
| cas | 59695-29-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 318.80 Pln | |
| Chemat | 5g | 1120.40 Pln | |
| Chemat | 10g | 1835.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-(4-methylpiperazin-1-yl)propanoic acid;dihydrochloride (CAS 59695-29-3) is a chemical compound with the molecular formula C8H18Cl2N2O2 and a molecular weight of 245.14 g/mol. IUPAC name: 3-(4-methylpiperazin-1-yl)propanoic acid;dihydrochloride. InChIKey: XCRQAPJDBCYMKE-UHFFFAOYSA-N.
| Molecular formula | C8H18Cl2N2O2 |
|---|---|
| Molecular weight | 245.14 g/mol |
| IUPAC name | 3-(4-methylpiperazin-1-yl)propanoic acid;dihydrochloride |
| InChIKey | XCRQAPJDBCYMKE-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CCC(=O)O.Cl.Cl |
Computed by PubChem (NCBI)