cas: 59695-29-3 — see every product listed under this CAS number, including other names
3-(4-Methylpiperazin-1-yl)propanoic acid dihydrochloride, 97% (CAS 59695-29-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g, 5g, 10g, 250mg, 2.5g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QK-1781-25g |
| cas | 59695-29-3 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 10g | price on request | |
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 1g | 471.73 Pln | |
| Fluorochem | 2.5g | 997.58 Pln | |
| Fluorochem | 5g | 1440.14 Pln | |
| Fluorochem | 10g | 2736.55 Pln | |
| Fluorochem | 25g | 5594.92 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
3-(4-methylpiperazin-1-yl)propanoic acid;dihydrochloride (CAS 59695-29-3) is a chemical compound with the molecular formula C8H18Cl2N2O2 and a molecular weight of 245.14 g/mol. IUPAC name: 3-(4-methylpiperazin-1-yl)propanoic acid;dihydrochloride. InChIKey: XCRQAPJDBCYMKE-UHFFFAOYSA-N.
| Molecular formula | C8H18Cl2N2O2 |
|---|---|
| Molecular weight | 245.14 g/mol |
| IUPAC name | 3-(4-methylpiperazin-1-yl)propanoic acid;dihydrochloride |
| InChIKey | XCRQAPJDBCYMKE-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CCC(=O)O.Cl.Cl |
Computed by PubChem (NCBI)