CAS 2044714-08-9 appears in our catalog under these names: 1,4-Dimethyl-1,4-diazepane-6-carboxylic acid dihydrochloride, 98%, 1,4-Dimethyl-1,4-diazepane-6-carboxylic acid dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1,4-dimethyl-1,4-diazepane-6-carboxylic acid;dihydrochloride (CAS 2044714-08-9) is a chemical compound with the molecular formula C8H18Cl2N2O2 and a molecular weight of 245.14 g/mol. IUPAC name: 1,4-dimethyl-1,4-diazepane-6-carboxylic acid;dihydrochloride. InChIKey: WBNMFCFNIHLHDS-UHFFFAOYSA-N.
| Molecular formula | C8H18Cl2N2O2 |
|---|---|
| Molecular weight | 245.14 g/mol |
| IUPAC name | 1,4-dimethyl-1,4-diazepane-6-carboxylic acid;dihydrochloride |
| InChIKey | WBNMFCFNIHLHDS-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC(C1)C(=O)O)C.Cl.Cl |
Computed by PubChem (NCBI)