cas: 330786-24-8 — see every product listed under this CAS number, including other names
3-(4-Phenoxyphenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine, 98%, 98% (CAS 330786-24-8) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KOV-1kg |
| cas | 330786-24-8 |
| size | 1kg |
| availability | 3000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 3789.20 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 122.00 Pln | |
| Chemat | 25g | 170.00 Pln | |
| Chemat | 100g | 491.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(4-phenoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine (CAS 330786-24-8) is a chemical compound with the molecular formula C17H13N5O and a molecular weight of 303.32 g/mol. IUPAC name: 3-(4-phenoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: YYVUOZULIDAKRN-UHFFFAOYSA-N.
| Molecular formula | C17H13N5O |
|---|---|
| Molecular weight | 303.32 g/mol |
| IUPAC name | 3-(4-phenoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | YYVUOZULIDAKRN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C3=C4C(=NC=NC4=NN3)N |
Computed by PubChem (NCBI)