cas: 330786-24-8 — see every product listed under this CAS number, including other names
Ibrutinib deacryloylpiperidine 98% (CAS 330786-24-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A150414-1g |
| cas | 330786-24-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 214.62 Pln | |
| Ambeed | 25g | 303.62 Pln | |
| Ambeed | 100g | 909.94 Pln | |
| Ambeed | 500g | 4253.00 Pln | |
| Ambeed | 1000g | 6767.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A150414 |
3-(4-phenoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine (CAS 330786-24-8) is a chemical compound with the molecular formula C17H13N5O and a molecular weight of 303.32 g/mol. IUPAC name: 3-(4-phenoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: YYVUOZULIDAKRN-UHFFFAOYSA-N.
| Molecular formula | C17H13N5O |
|---|---|
| Molecular weight | 303.32 g/mol |
| IUPAC name | 3-(4-phenoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | YYVUOZULIDAKRN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C3=C4C(=NC=NC4=NN3)N |
Computed by PubChem (NCBI)