cas: 330786-24-8 — see every product listed under this CAS number, including other names
Ibrutinib deacryloylpiperidine, 99.97% (CAS 330786-24-8) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 1 g, 500 mg, 100 mg, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-78727-10mM/1mL |
| cas | 330786-24-8 |
| size | 10mM/1mL |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 277.90 Pln | |
| MedChemExpress | 1 g | 407.93 Pln | |
| MedChemExpress | 500 mg | 361.49 Pln | |
| MedChemExpress | 100 mg | 263.96 Pln | |
| MedChemExpress | 5 g | 598.33 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.97% |
3-(4-phenoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine (CAS 330786-24-8) is a chemical compound with the molecular formula C17H13N5O and a molecular weight of 303.32 g/mol. IUPAC name: 3-(4-phenoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: YYVUOZULIDAKRN-UHFFFAOYSA-N.
| Molecular formula | C17H13N5O |
|---|---|
| Molecular weight | 303.32 g/mol |
| IUPAC name | 3-(4-phenoxyphenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | YYVUOZULIDAKRN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C3=C4C(=NC=NC4=NN3)N |
Computed by PubChem (NCBI)