cas: 924832-42-8 — see every product listed under this CAS number, including other names
3-(5-Amino-1-methyl-1H-benzo[d]imidazol-2-yl)propanoic acid, 97%, 97% (CAS 924832-42-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1208IR-100mg |
| cas | 924832-42-8 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 678.80 Pln | |
| Chemat | 250mg | 1091.60 Pln | |
| Chemat | 500mg | 1778.00 Pln | |
| Chemat | 1g | 2632.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-(5-amino-1-methylbenzimidazol-2-yl)propanoic acid (CAS 924832-42-8) is a chemical compound with the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. IUPAC name: 3-(5-amino-1-methylbenzimidazol-2-yl)propanoic acid. InChIKey: LAJGKMSQNZIEHN-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 3-(5-amino-1-methylbenzimidazol-2-yl)propanoic acid |
| InChIKey | LAJGKMSQNZIEHN-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)N)N=C1CCC(=O)O |
Computed by PubChem (NCBI)