CAS 7150-46-1 is the registry number for 4-Nitrogramine, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N,N-dimethyl-1-(4-nitro-1H-indol-3-yl)methanamine (CAS 7150-46-1) is a chemical compound with the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. IUPAC name: N,N-dimethyl-1-(4-nitro-1H-indol-3-yl)methanamine. InChIKey: NTWUAOHAQNZERF-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | N,N-dimethyl-1-(4-nitro-1H-indol-3-yl)methanamine |
| InChIKey | NTWUAOHAQNZERF-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=CNC2=C1C(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)