3-(5-Bromo-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 98%, 98%
cas: 1010100-26-1 — see every product listed under this CAS number, including other names
3-(5-Bromo-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 98%, 98% (CAS 1010100-26-1) is a chemical reagent available from Chemat. Available pack sizes: 250g, 500g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JLSX-250g |
| cas | 1010100-26-1 |
| size | 250g |
| availability | 1000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250g | 2046.80 Pln | |
| Chemat | 500g | 3816.00 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 198.80 Pln | |
| Chemat | 10g | 294.80 Pln | |
| Chemat | 25g | 568.40 Pln | |
| Chemat | 50g | 1062.80 Pln | |
| Chemat | 100g | 1696.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(6-bromo-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 1010100-26-1) is a chemical compound with the molecular formula C13H11BrN2O3 and a molecular weight of 323.14 g/mol. IUPAC name: 3-(6-bromo-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: CMRQAKJTXKOGSF-UHFFFAOYSA-N.
| Molecular formula | C13H11BrN2O3 |
|---|---|
| Molecular weight | 323.14 g/mol |
| IUPAC name | 3-(6-bromo-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | CMRQAKJTXKOGSF-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC(=C3)Br |
Computed by PubChem (NCBI)
Synonyms:
3-(5-Bromo-1-oxoisoindolin-2-yl)piperidine-2,6-dione, Lenalidomide-5-Br, 3-(5-Bromo-1-oxo-2-isoindolinyl)piperidine-2,6-dione, 3-(6-bromo-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione, 3-(5-bromo-1-oxo-isoindolin-2-yl)piperidine-2,6-dione, 3-(5-bromo-1-oxo-2,3-dihydro-1H-isoindol-2-yl)piperidine-2,6-dione, Lenalidomide-5'-Bromide, orb1692032, 3-(5-bromo-1-oxo-3H-isoindol-2-yl)piperidine-2,6-dione, CMRQAKJTXKOGSF-UHFFFAOYSA-N