CAS 25407-30-1 is the registry number for 1-(2-(4-NITRO-PHENYL)-2-OXO-ETHYL)PYRIDINIUM BROMIDE, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
1-(4-nitrophenyl)-2-pyridin-1-ium-1-ylethanone bromide (CAS 25407-30-1) is a chemical compound with the molecular formula C13H11BrN2O3 and a molecular weight of 323.14 g/mol. IUPAC name: 1-(4-nitrophenyl)-2-pyridin-1-ium-1-ylethanone bromide. InChIKey: LWISKYAUPKPTNZ-UHFFFAOYSA-M.
| Molecular formula | C13H11BrN2O3 |
|---|---|
| Molecular weight | 323.14 g/mol |
| IUPAC name | 1-(4-nitrophenyl)-2-pyridin-1-ium-1-ylethanone bromide |
| InChIKey | LWISKYAUPKPTNZ-UHFFFAOYSA-M |
| SMILES | C1=CC=[N+](C=C1)CC(=O)C2=CC=C(C=C2)[N+](=O)[O-].[Br-] |
Computed by PubChem (NCBI)