CAS 713530-47-3 is the registry number for 4-Bromo-2-nitro-6-(phenylmethoxy)benzenamine. Offered by: TRC. Available pack sizes: 1g.
4-bromo-2-nitro-6-phenylmethoxyaniline (CAS 713530-47-3) is a chemical compound with the molecular formula C13H11BrN2O3 and a molecular weight of 323.14 g/mol. IUPAC name: 4-bromo-2-nitro-6-phenylmethoxyaniline. InChIKey: DFUKAZCXDQPEIR-UHFFFAOYSA-N.
| Molecular formula | C13H11BrN2O3 |
|---|---|
| Molecular weight | 323.14 g/mol |
| IUPAC name | 4-bromo-2-nitro-6-phenylmethoxyaniline |
| InChIKey | DFUKAZCXDQPEIR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC(=C2N)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)