Products 2243825-20-7
CAS 2243825-20-7 appears in our catalog under these names: (R)-3-(5-Bromo-1-oxoisoindolin-2-yl)piperidine-2,6-dione 95%, (3R)-3-(5-bromo-1-oxo-isoindolin-2-yl)piperidine-2,6-dione, 95%, 95%, (R)-Desamino lenalidomide-5-Br, 99.69%, (R)-3-(5-Bromo-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 97%. Offered by: Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 500mg, 5 mg, 10 mg, 50 mg.
(3R)-3-(6-bromo-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 2243825-20-7) is a chemical compound with the molecular formula C13H11BrN2O3 and a molecular weight of 323.14 g/mol. IUPAC name: (3R)-3-(6-bromo-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: CMRQAKJTXKOGSF-SNVBAGLBSA-N.
| Molecular formula | C13H11BrN2O3 |
|---|---|
| Molecular weight | 323.14 g/mol |
| IUPAC name | (3R)-3-(6-bromo-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | CMRQAKJTXKOGSF-SNVBAGLBSA-N |
| SMILES | C1CC(=O)NC(=O)[C@@H]1N2CC3=C(C2=O)C=CC(=C3)Br |
Computed by PubChem (NCBI)