3-(5-Chloro-1H-indol-3-yl)propan-1-amine, 97%
cas: 54298-68-9 — see every product listed under this CAS number, including other names
3-(5-Chloro-1H-indol-3-yl)propan-1-amine, 97% (CAS 54298-68-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A207774-250mg |
| cas | 54298-68-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 387.06 Pln | |
| Ambeed | 1g | 704.12 Pln | |
| BLDpharm | 100mg | 353.23 Pln | |
| BLDpharm | 250mg | 414.32 Pln | |
| BLDpharm | 1g | 753.09 Pln | |
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 309.20 Pln | |
| Chemat | 1g | 582.80 Pln | |
| Chemat | 5g | 2675.60 Pln | |
| Fluorochem | 100mg | 336.36 Pln | |
| Fluorochem | 250mg | 393.63 Pln | |
| Fluorochem | 1g | 726.85 Pln | |
| Fluorochem | 5g | 3309.27 Pln | |
| Fluorochem | 10g | 6427.96 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-(5-chloro-1H-indol-3-yl)propan-1-amine (CAS 54298-68-9) is a chemical compound with the molecular formula C11H13ClN2 and a molecular weight of 208.69 g/mol. IUPAC name: 3-(5-chloro-1H-indol-3-yl)propan-1-amine. InChIKey: LHRVIXGXFXJLTO-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2 |
|---|---|
| Molecular weight | 208.69 g/mol |
| IUPAC name | 3-(5-chloro-1H-indol-3-yl)propan-1-amine |
| InChIKey | LHRVIXGXFXJLTO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=CN2)CCCN |
Computed by PubChem (NCBI)