CAS 886457-43-8 is the registry number for [4-(Pyrrol-1-yl)phenyl]methanamine hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
(4-pyrrol-1-ylphenyl)methanamine;hydrochloride (CAS 886457-43-8) is a chemical compound with the molecular formula C11H13ClN2 and a molecular weight of 208.69 g/mol. IUPAC name: (4-pyrrol-1-ylphenyl)methanamine;hydrochloride. InChIKey: FINGFRBGAKNYGM-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2 |
|---|---|
| Molecular weight | 208.69 g/mol |
| IUPAC name | (4-pyrrol-1-ylphenyl)methanamine;hydrochloride |
| InChIKey | FINGFRBGAKNYGM-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)