CAS 1203-95-8 appears in our catalog under these names: 2-(5-Chloro-2-methyl-1h-indol-3-yl)ethanamine hydrochloride, 95%, 5-Chloro-2-methyltriptamine, 2-(5-chloro-2-methyl-1H-indol-3-yl)ethanamine. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 1g, 250mg.
2-(5-chloro-2-methyl-1H-indol-3-yl)ethanamine (CAS 1203-95-8) is a chemical compound with the molecular formula C11H13ClN2 and a molecular weight of 208.69 g/mol. IUPAC name: 2-(5-chloro-2-methyl-1H-indol-3-yl)ethanamine. InChIKey: PPPQHAMKVHECAL-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2 |
|---|---|
| Molecular weight | 208.69 g/mol |
| IUPAC name | 2-(5-chloro-2-methyl-1H-indol-3-yl)ethanamine |
| InChIKey | PPPQHAMKVHECAL-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C=CC(=C2)Cl)CCN |
Computed by PubChem (NCBI)