Products 1170838-15-9
CAS 1170838-15-9 appears in our catalog under these names: 2-Amino-3,6-dimethylquinoline hydrochloride, 95%, 3,6-Dimethylquinolin-2-amine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
3,6-dimethylquinolin-2-amine;hydrochloride (CAS 1170838-15-9) is a chemical compound with the molecular formula C11H13ClN2 and a molecular weight of 208.69 g/mol. IUPAC name: 3,6-dimethylquinolin-2-amine;hydrochloride. InChIKey: VOXYVBRJWCFCLV-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2 |
|---|---|
| Molecular weight | 208.69 g/mol |
| IUPAC name | 3,6-dimethylquinolin-2-amine;hydrochloride |
| InChIKey | VOXYVBRJWCFCLV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(C(=C2)C)N.Cl |
Computed by PubChem (NCBI)