CAS 859155-81-0 appears in our catalog under these names: 3–(5–Ethyl–1,2,4–oxadiazol–3–yl)benzoic acid, 3-(5-Ethyl-1,2,4-oxadiazol-3-yl)benzoic acid, 98%, 3-(5-Ethyl-1,2,4-oxadiazol-3-yl)benzoic acid, 98+%. Offered by: GLPBio, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 10g.
3-(5-ethyl-1,2,4-oxadiazol-3-yl)benzoic acid (CAS 859155-81-0) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: 3-(5-ethyl-1,2,4-oxadiazol-3-yl)benzoic acid. InChIKey: ZUEUZEBBRRWMHB-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 3-(5-ethyl-1,2,4-oxadiazol-3-yl)benzoic acid |
| InChIKey | ZUEUZEBBRRWMHB-UHFFFAOYSA-N |
| SMILES | CCC1=NC(=NO1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)