cas: 852180-74-6 — see every product listed under this CAS number, including other names
3-(5-Pyrimidinyl)benzoic acid, 95% (CAS 852180-74-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F039422-250MG |
| cas | 852180-74-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 372.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-pyrimidin-5-ylbenzoic acid (CAS 852180-74-6) is a chemical compound with the molecular formula C11H8N2O2 and a molecular weight of 200.19 g/mol. IUPAC name: 3-pyrimidin-5-ylbenzoic acid. InChIKey: URQRFVRGUHUTMI-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 3-pyrimidin-5-ylbenzoic acid |
| InChIKey | URQRFVRGUHUTMI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CN=CN=C2 |
Computed by PubChem (NCBI)