cas: 852180-74-6 — see every product listed under this CAS number, including other names
3-Pyrimidin-5-ylbenzoic acid, 97% (CAS 852180-74-6) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC41701CB |
| cas | 852180-74-6 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 108.94 Pln | |
| Thermo Scientific | 1g | 311.05 Pln | |
| Thermo Scientific | 5g | 677.08 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
3-pyrimidin-5-ylbenzoic acid (CAS 852180-74-6) is a chemical compound with the molecular formula C11H8N2O2 and a molecular weight of 200.19 g/mol. IUPAC name: 3-pyrimidin-5-ylbenzoic acid. InChIKey: URQRFVRGUHUTMI-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 3-pyrimidin-5-ylbenzoic acid |
| InChIKey | URQRFVRGUHUTMI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CN=CN=C2 |
Computed by PubChem (NCBI)