cas: 878437-60-6 — see every product listed under this CAS number, including other names
3-(8-Methylimidazo[1,2-a]pyridin-2-yl)aniline, 97%, 97% (CAS 878437-60-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GYA0-100mg |
| cas | 878437-60-6 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 693.20 Pln | |
| Chemat | 250mg | 957.20 Pln | |
| Chemat | 500mg | 1470.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-(8-methylimidazo[1,2-a]pyridin-2-yl)aniline (CAS 878437-60-6) is a chemical compound with the molecular formula C14H13N3 and a molecular weight of 223.27 g/mol. IUPAC name: 3-(8-methylimidazo[1,2-a]pyridin-2-yl)aniline. InChIKey: WQRLDBJIXDSJHU-UHFFFAOYSA-N.
| Molecular formula | C14H13N3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 3-(8-methylimidazo[1,2-a]pyridin-2-yl)aniline |
| InChIKey | WQRLDBJIXDSJHU-UHFFFAOYSA-N |
| SMILES | CC1=CC=CN2C1=NC(=C2)C3=CC(=CC=C3)N |
Computed by PubChem (NCBI)