CAS 64730-34-3 is the registry number for 4-(7-Methylimidazo[1,2-a]pyridin-2-yl)aniline, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g.
4-(7-methylimidazo[1,2-a]pyridin-2-yl)aniline (CAS 64730-34-3) is a chemical compound with the molecular formula C14H13N3 and a molecular weight of 223.27 g/mol. IUPAC name: 4-(7-methylimidazo[1,2-a]pyridin-2-yl)aniline. InChIKey: ZMLUDLQZWAWHGB-UHFFFAOYSA-N.
| Molecular formula | C14H13N3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 4-(7-methylimidazo[1,2-a]pyridin-2-yl)aniline |
| InChIKey | ZMLUDLQZWAWHGB-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC(=CN2C=C1)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)