CAS 155242-92-5 is the registry number for 1-Benzyl-1,3-benzodiazol-4-amine, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
1-benzylbenzimidazol-4-amine (CAS 155242-92-5) is a chemical compound with the molecular formula C14H13N3 and a molecular weight of 223.27 g/mol. IUPAC name: 1-benzylbenzimidazol-4-amine. InChIKey: CCLYBXATLKLSKT-UHFFFAOYSA-N.
| Molecular formula | C14H13N3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 1-benzylbenzimidazol-4-amine |
| InChIKey | CCLYBXATLKLSKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=NC3=C(C=CC=C32)N |
Computed by PubChem (NCBI)