CAS 878437-60-6 appears in our catalog under these names: 3-(8-Methylimidazo[1,2-a]pyridin-2-yl)aniline, 95%, 3-(8-Methyl-imidazo(1,2-a)pyridin-2-yl)-phenylamine, 3-(8-Methylimidazo[1,2-a]pyridin-2-yl)aniline, 97%, 97%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg, 500mg.
3-(8-methylimidazo[1,2-a]pyridin-2-yl)aniline (CAS 878437-60-6) is a chemical compound with the molecular formula C14H13N3 and a molecular weight of 223.27 g/mol. IUPAC name: 3-(8-methylimidazo[1,2-a]pyridin-2-yl)aniline. InChIKey: WQRLDBJIXDSJHU-UHFFFAOYSA-N.
| Molecular formula | C14H13N3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 3-(8-methylimidazo[1,2-a]pyridin-2-yl)aniline |
| InChIKey | WQRLDBJIXDSJHU-UHFFFAOYSA-N |
| SMILES | CC1=CC=CN2C1=NC(=C2)C3=CC(=CC=C3)N |
Computed by PubChem (NCBI)