CAS 41034-83-7 appears in our catalog under these names: 3-Anthracen-9-yl-propionic acid, 95%, 3-(9-Anthryl)propionic acid, 96% , 3-(Anthracen-9-yl)propanoic acid, 95%, 95%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 25g.
3-anthracen-9-ylpropanoic acid (CAS 41034-83-7) is a chemical compound with the molecular formula C17H14O2 and a molecular weight of 250.29 g/mol. IUPAC name: 3-anthracen-9-ylpropanoic acid. InChIKey: BDGMYCZUEIGHJH-UHFFFAOYSA-N.
| Molecular formula | C17H14O2 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | 3-anthracen-9-ylpropanoic acid |
| InChIKey | BDGMYCZUEIGHJH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2CCC(=O)O |
Computed by PubChem (NCBI)