cas: 1333146-86-3 — see every product listed under this CAS number, including other names
3-(Benzyloxy)-5-bromo-1-methylpyridin-2(1H)-one, 95+% (CAS 1333146-86-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A144350-5g |
| cas | 1333146-86-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8064.28 Pln | |
| AmBeed | 1g | 3624.46 Pln | |
| AmBeed | 25g | 20127.31 Pln | |
| AmBeed | 10g | 12087.46 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-bromo-1-methyl-3-phenylmethoxypyridin-2-one (CAS 1333146-86-3) is a chemical compound with the molecular formula C13H12BrNO2 and a molecular weight of 294.14 g/mol. IUPAC name: 5-bromo-1-methyl-3-phenylmethoxypyridin-2-one. InChIKey: ARIKPCZRYQDZJY-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO2 |
|---|---|
| Molecular weight | 294.14 g/mol |
| IUPAC name | 5-bromo-1-methyl-3-phenylmethoxypyridin-2-one |
| InChIKey | ARIKPCZRYQDZJY-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=C(C1=O)OCC2=CC=CC=C2)Br |
Computed by PubChem (NCBI)