cas: 1333146-86-3 — see every product listed under this CAS number, including other names
3-(Benzyloxy)-5-bromo-1-methylpyridin-2(1H)-one, 97%, 97% (CAS 1333146-86-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1125M7-100mg |
| cas | 1333146-86-3 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 621.20 Pln | |
| Chemat | 250mg | 1178.00 Pln | |
| Chemat | 500mg | 1734.80 Pln | |
| Chemat | 1g | 2848.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-bromo-1-methyl-3-phenylmethoxypyridin-2-one (CAS 1333146-86-3) is a chemical compound with the molecular formula C13H12BrNO2 and a molecular weight of 294.14 g/mol. IUPAC name: 5-bromo-1-methyl-3-phenylmethoxypyridin-2-one. InChIKey: ARIKPCZRYQDZJY-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO2 |
|---|---|
| Molecular weight | 294.14 g/mol |
| IUPAC name | 5-bromo-1-methyl-3-phenylmethoxypyridin-2-one |
| InChIKey | ARIKPCZRYQDZJY-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=C(C1=O)OCC2=CC=CC=C2)Br |
Computed by PubChem (NCBI)