3-(Benzyloxy)-5-chloroaniline, 98%
cas: 1100752-67-7 — see every product listed under this CAS number, including other names
3-(Benzyloxy)-5-chloroaniline, 98% (CAS 1100752-67-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 25g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A732876-250mg |
| cas | 1100752-67-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 464.94 Pln | |
| Ambeed | 5g | 1527.38 Pln | |
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 582.80 Pln | |
| BLDpharm | 250mg | 269.93 Pln | |
| BLDpharm | 1g | 497.63 Pln | |
| BLDpharm | 5g | 1641.67 Pln | |
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 476.93 Pln | |
| Fluorochem | 5g | 1580.71 Pln | |
| Fluorochem | 25g | 7370.34 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
3-chloro-5-phenylmethoxyaniline (CAS 1100752-67-7) is a chemical compound with the molecular formula C13H12ClNO and a molecular weight of 233.69 g/mol. IUPAC name: 3-chloro-5-phenylmethoxyaniline. InChIKey: UXNQKFKPKHSVRW-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 3-chloro-5-phenylmethoxyaniline |
| InChIKey | UXNQKFKPKHSVRW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC(=C2)N)Cl |
Computed by PubChem (NCBI)