3-(Benzyloxy)cyclobutanecarboxylic acid, 97%, 97%
cas: 4958-02-5 — see every product listed under this CAS number, including other names
3-(Benzyloxy)cyclobutanecarboxylic acid, 97%, 97% (CAS 4958-02-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DBCE-100mg |
| cas | 4958-02-5 |
| size | 100mg |
| availability | 5000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 184.40 Pln | |
| Chemat | 10g | 280.40 Pln | |
| Chemat | 25g | 573.20 Pln | |
| Chemat | 50g | 990.80 Pln | |
| Chemat | 100g | 1782.80 Pln | |
| Chemat | 250g | 4264.40 Pln | |
| Chemat | 1kg | 9918.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-phenylmethoxycyclobutane-1-carboxylic acid (CAS 4958-02-5) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 3-phenylmethoxycyclobutane-1-carboxylic acid. InChIKey: YNNOFVDQHAHVFG-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 3-phenylmethoxycyclobutane-1-carboxylic acid |
| InChIKey | YNNOFVDQHAHVFG-UHFFFAOYSA-N |
| SMILES | C1C(CC1OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(benzyloxy)cyclobutane-1-carboxylic acid, 3-(benzyloxy)cyclobutanecarboxylic acid, 3-Benzyloxy-cyclobutanecarboxylic acid, 3-Benzyloxycyclobutanecarboxylic acid, cis-3-(Benzyloxy)cyclobutanecarboxylic acid, trans-3-(Benzyloxy)cyclobutanecarboxylic acid, trans-3-Benzyloxycyclobutanecarboxylic acid, cis-3-Benzyloxycyclobutanecarboxylic acid, Cyclobutanecarboxylic acid, 3-(phenylmethoxy)-, trans-3-Phenylmethoxy-1-cyclobutanecarboxylic acid