CAS 84182-48-9 appears in our catalog under these names: Trans-3-benzyloxycyclobutanecarboxylic acid, 95%, trans-3-(Benzyloxy)cyclobutanecarboxylic acid, 98+%, trans-3-(Benzyloxy)cyclobutanecarboxylic acid, 95%, 95%, trans-3-(Benzyloxy)cyclobutanecarboxylic acid, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 25mg, 50mg, 100mg.
3-phenylmethoxycyclobutane-1-carboxylic acid (CAS 84182-48-9) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 3-phenylmethoxycyclobutane-1-carboxylic acid. InChIKey: YNNOFVDQHAHVFG-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 3-phenylmethoxycyclobutane-1-carboxylic acid |
| InChIKey | YNNOFVDQHAHVFG-UHFFFAOYSA-N |
| SMILES | C1C(CC1OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)