cas: 75383-61-8 — see every product listed under this CAS number, including other names
3-(Cbz-aminomethyl)phenol, 95%+, 95%+ (CAS 75383-61-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G52O-100mg |
| cas | 75383-61-8 |
| size | 100mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 294.80 Pln | |
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 410.00 Pln | |
| Chemat | 5g | 928.40 Pln | |
| Chemat | 10g | 1408.40 Pln | |
| Chemat | 25g | 2752.40 Pln | |
| Chemat | 100g | 10221.20 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
Benzyl N-[(3-hydroxyphenyl)methyl]carbamate (CAS 75383-61-8) is a chemical compound with the molecular formula C15H15NO3 and a molecular weight of 257.28 g/mol. IUPAC name: benzyl N-[(3-hydroxyphenyl)methyl]carbamate. InChIKey: LQSKRMJMDBYZAY-UHFFFAOYSA-N.
| Molecular formula | C15H15NO3 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | benzyl N-[(3-hydroxyphenyl)methyl]carbamate |
| InChIKey | LQSKRMJMDBYZAY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCC2=CC(=CC=C2)O |
Computed by PubChem (NCBI)