cas: 917396-29-3 — see every product listed under this CAS number, including other names
3-(Chloromethyl)-2-methyl-6-(trifluoromethyl)pyridine, 98% (CAS 917396-29-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A861040-100mg |
| cas | 917396-29-3 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 909.79 Pln | |
| AmBeed | 5g | 8194.48 Pln | |
| AmBeed | 10g | 12764.50 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(chloromethyl)-2-methyl-6-(trifluoromethyl)pyridine (CAS 917396-29-3) is a chemical compound with the molecular formula C8H7ClF3N and a molecular weight of 209.59 g/mol. IUPAC name: 3-(chloromethyl)-2-methyl-6-(trifluoromethyl)pyridine. InChIKey: ZQKHRMBSNRCFPL-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3N |
|---|---|
| Molecular weight | 209.59 g/mol |
| IUPAC name | 3-(chloromethyl)-2-methyl-6-(trifluoromethyl)pyridine |
| InChIKey | ZQKHRMBSNRCFPL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)C(F)(F)F)CCl |
Computed by PubChem (NCBI)