cas: 59815-29-1 — see every product listed under this CAS number, including other names
3-(Chlorosulfonyl)-4-isopropylbenzoic acid 97% (CAS 59815-29-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A656715-250mg |
| cas | 59815-29-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 387.06 Pln | |
| Ambeed | 1g | 637.38 Pln | |
| Ambeed | 5g | 1577.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A656715 |
3-chlorosulfonyl-4-propan-2-ylbenzoic acid (CAS 59815-29-1) is a chemical compound with the molecular formula C10H11ClO4S and a molecular weight of 262.71 g/mol. IUPAC name: 3-chlorosulfonyl-4-propan-2-ylbenzoic acid. InChIKey: KSRCCOHUNHPILB-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO4S |
|---|---|
| Molecular weight | 262.71 g/mol |
| IUPAC name | 3-chlorosulfonyl-4-propan-2-ylbenzoic acid |
| InChIKey | KSRCCOHUNHPILB-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=C(C=C1)C(=O)O)S(=O)(=O)Cl |
Computed by PubChem (NCBI)