Products 175205-43-3
CAS 175205-43-3 is the registry number for 3-(4-Chlorobenzenesulfonyl)butyric acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
3-(4-chlorophenyl)sulfonylbutanoic acid (CAS 175205-43-3) is a chemical compound with the molecular formula C10H11ClO4S and a molecular weight of 262.71 g/mol. IUPAC name: 3-(4-chlorophenyl)sulfonylbutanoic acid. InChIKey: NPUIQANQRDIHLU-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO4S |
|---|---|
| Molecular weight | 262.71 g/mol |
| IUPAC name | 3-(4-chlorophenyl)sulfonylbutanoic acid |
| InChIKey | NPUIQANQRDIHLU-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)O)S(=O)(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)
Synonyms:
3-(4-chlorobenzenesulfonyl)butyric acid, 3-(4-chlorophenyl)sulfonylbutanoic acid, 3-((4-Chlorophenyl)sulfonyl)butanoic acid, 3-(4-Chlorophenylsulfonyl)butyric acid, 3-(4'-Chlorobenzenesulfonyl)Butyric Acid, Butanoic acid, 3-[(4-chlorophenyl)sulfonyl]-, 3-(4-chlorobenzenesulphonyl)butyric acid, 3-(4-chlorobenzenesulfonyl)butanoic acid, 3-[(4-chlorophenyl)sulfonyl]butanoic acid, Maybridge3_006195