Products 446847-82-1
CAS 446847-82-1 appears in our catalog under these names: Ethyl 4-[(chlorosulfonyl)methyl]benzoate, 95%, Ethyl 4-((chlorosulfonyl)methyl)benzoate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
Ethyl 4-(chlorosulfonylmethyl)benzoate (CAS 446847-82-1) is a chemical compound with the molecular formula C10H11ClO4S and a molecular weight of 262.71 g/mol. IUPAC name: ethyl 4-(chlorosulfonylmethyl)benzoate. InChIKey: QIYYMJAPJWLWKV-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO4S |
|---|---|
| Molecular weight | 262.71 g/mol |
| IUPAC name | ethyl 4-(chlorosulfonylmethyl)benzoate |
| InChIKey | QIYYMJAPJWLWKV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)