CAS 59815-29-1 appears in our catalog under these names: 3-Chlorosulfonyl-4-isopropyl-benzoic acid, 97%, 3-Chlorosulfonyl-4-isopropyl-benzoic acid, 97%, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
3-chlorosulfonyl-4-propan-2-ylbenzoic acid (CAS 59815-29-1) is a chemical compound with the molecular formula C10H11ClO4S and a molecular weight of 262.71 g/mol. IUPAC name: 3-chlorosulfonyl-4-propan-2-ylbenzoic acid. InChIKey: KSRCCOHUNHPILB-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO4S |
|---|---|
| Molecular weight | 262.71 g/mol |
| IUPAC name | 3-chlorosulfonyl-4-propan-2-ylbenzoic acid |
| InChIKey | KSRCCOHUNHPILB-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=C(C=C1)C(=O)O)S(=O)(=O)Cl |
Computed by PubChem (NCBI)