cas: 2096353-44-3 — see every product listed under this CAS number, including other names
3-(Cyclopropylcarbamoyl)-2-fluorophenylboronic acid, 95%, 95% (CAS 2096353-44-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHML-250mg |
| cas | 2096353-44-3 |
| size | 250mg |
| availability | 4.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 467.60 Pln | |
| Chemat | 1g | 875.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[3-(cyclopropylcarbamoyl)-2-fluorophenyl]boronic acid (CAS 2096353-44-3) is a chemical compound with the molecular formula C10H11BFNO3 and a molecular weight of 223.01 g/mol. IUPAC name: [3-(cyclopropylcarbamoyl)-2-fluorophenyl]boronic acid. InChIKey: RPJJVCOYLPAZSB-UHFFFAOYSA-N.
| Molecular formula | C10H11BFNO3 |
|---|---|
| Molecular weight | 223.01 g/mol |
| IUPAC name | [3-(cyclopropylcarbamoyl)-2-fluorophenyl]boronic acid |
| InChIKey | RPJJVCOYLPAZSB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C(=O)NC2CC2)F)(O)O |
Computed by PubChem (NCBI)