CAS 874289-20-0 appears in our catalog under these names: N-Cyclopropyl 4-borono-2-fluorobenzamide, 98%, 4–(Cyclopropylcarbamoyl)–3–fluorophenylboronic acid, (4-(Cyclopropylcarbamoyl)-3-fluorophenyl)boronic acid 98%, (4-(cyclopropylcarbamoyl)-3-fluorophenyl)boronic acid, ≥99%, ≥99%, (4-(Cyclopropylcarbamoyl)-3-fluorophenyl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
[4-(cyclopropylcarbamoyl)-3-fluorophenyl]boronic acid (CAS 874289-20-0) is a chemical compound with the molecular formula C10H11BFNO3 and a molecular weight of 223.01 g/mol. IUPAC name: [4-(cyclopropylcarbamoyl)-3-fluorophenyl]boronic acid. InChIKey: HXTFTZYMPDZCQF-UHFFFAOYSA-N.
| Molecular formula | C10H11BFNO3 |
|---|---|
| Molecular weight | 223.01 g/mol |
| IUPAC name | [4-(cyclopropylcarbamoyl)-3-fluorophenyl]boronic acid |
| InChIKey | HXTFTZYMPDZCQF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)NC2CC2)F)(O)O |
Computed by PubChem (NCBI)