CAS 1704081-55-9 appears in our catalog under these names: (3-(Cyclopropylcarbamoyl)-4-fluorophenyl)boronic acid, 95%, (3-(cyclopropylcarbamoyl)-4-fluorophenyl)boronic acid, 95+%, (3–(Cyclopropylcarbamoyl)–4–fluorophenyl)boronic acid, (3-(Cyclopropylcarbamoyl)-4-fluorophenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 250mg, 1g, 500mg, 100mg.
[3-(cyclopropylcarbamoyl)-4-fluorophenyl]boronic acid (CAS 1704081-55-9) is a chemical compound with the molecular formula C10H11BFNO3 and a molecular weight of 223.01 g/mol. IUPAC name: [3-(cyclopropylcarbamoyl)-4-fluorophenyl]boronic acid. InChIKey: RFPZSWXIIAPJOC-UHFFFAOYSA-N.
| Molecular formula | C10H11BFNO3 |
|---|---|
| Molecular weight | 223.01 g/mol |
| IUPAC name | [3-(cyclopropylcarbamoyl)-4-fluorophenyl]boronic acid |
| InChIKey | RFPZSWXIIAPJOC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C(=O)NC2CC2)(O)O |
Computed by PubChem (NCBI)