CAS 2096353-44-3 appears in our catalog under these names: 3-(Cyclopropylcarbamoyl)-2-fluorophenylboronic acid, 3-(Cyclopropylcarbamoyl)-2-fluorophenylboronic acid, 98%, 3-(Cyclopropylcarbamoyl)-2-fluorophenylboronic acid, 95%, 95%. Offered by: Fluorochem, Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
[3-(cyclopropylcarbamoyl)-2-fluorophenyl]boronic acid (CAS 2096353-44-3) is a chemical compound with the molecular formula C10H11BFNO3 and a molecular weight of 223.01 g/mol. IUPAC name: [3-(cyclopropylcarbamoyl)-2-fluorophenyl]boronic acid. InChIKey: RPJJVCOYLPAZSB-UHFFFAOYSA-N.
| Molecular formula | C10H11BFNO3 |
|---|---|
| Molecular weight | 223.01 g/mol |
| IUPAC name | [3-(cyclopropylcarbamoyl)-2-fluorophenyl]boronic acid |
| InChIKey | RPJJVCOYLPAZSB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C(=O)NC2CC2)F)(O)O |
Computed by PubChem (NCBI)