cas: 1150271-63-8 — see every product listed under this CAS number, including other names
3-(Ethoxycarbonyl)-5-methylphenylboronic acid, pinacol ester, 95%, 95% (CAS 1150271-63-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111FQP-250mg |
| cas | 1150271-63-8 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 645.20 Pln | |
| Chemat | 5g | 2186.00 Pln | |
| Chemat | 100mg | 194.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1150271-63-8) is a chemical compound with the molecular formula C16H23BO4 and a molecular weight of 290.2 g/mol. IUPAC name: ethyl 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: RNSMBQXQPVWMCE-UHFFFAOYSA-N.
| Molecular formula | C16H23BO4 |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | ethyl 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | RNSMBQXQPVWMCE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)C(=O)OCC)C |
Computed by PubChem (NCBI)