cas: 83164-93-6 — see every product listed under this CAS number, including other names
3-(Ethylsulfonyl)aniline 96% (CAS 83164-93-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A391236-250mg |
| cas | 83164-93-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 804.25 Pln | |
| Ambeed | 1g | 1905.62 Pln | |
| Ambeed | 5g | 5571.31 Pln | |
| Ambeed | 100mg | 576.19 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A391236 |
3-ethylsulfonylaniline (CAS 83164-93-6) is a chemical compound with the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. IUPAC name: 3-ethylsulfonylaniline. InChIKey: ZCIQLGLOYPISKI-UHFFFAOYSA-N.
| Molecular formula | C8H11NO2S |
|---|---|
| Molecular weight | 185.25 g/mol |
| IUPAC name | 3-ethylsulfonylaniline |
| InChIKey | ZCIQLGLOYPISKI-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=CC=CC(=C1)N |
Computed by PubChem (NCBI)