cas: 83164-93-6 — see every product listed under this CAS number, including other names
3-(Ethylsulfonyl)aniline, 96%, 96% (CAS 83164-93-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G9TL-100mg |
| cas | 83164-93-6 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 434.00 Pln | |
| Chemat | 250mg | 693.20 Pln | |
| Chemat | 1g | 1768.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
3-ethylsulfonylaniline (CAS 83164-93-6) is a chemical compound with the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. IUPAC name: 3-ethylsulfonylaniline. InChIKey: ZCIQLGLOYPISKI-UHFFFAOYSA-N.
| Molecular formula | C8H11NO2S |
|---|---|
| Molecular weight | 185.25 g/mol |
| IUPAC name | 3-ethylsulfonylaniline |
| InChIKey | ZCIQLGLOYPISKI-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=CC=CC(=C1)N |
Computed by PubChem (NCBI)