CAS 373384-18-0 appears in our catalog under these names: 3–(methylsulfonyl)phenylboronic acid, 3-(Methanesulfonyl)phenylboronic acid/ 95+%, 3-(Methylsulfonyl)benzeneboronic acid, 98% , (3-(Methylsulfonyl)phenyl)boronic acid, 98%, 98%, 3-Methylsulfonylphenylboronic acid, 96%. Offered by: GLPBio, Chemat, Thermo Scientific (Alfa Aesar), Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 10g, 25g, 100g.
(3-methylsulfonylphenyl)boronic acid (CAS 373384-18-0) is a chemical compound with the molecular formula C7H9BO4S and a molecular weight of 200.02 g/mol. IUPAC name: (3-methylsulfonylphenyl)boronic acid. InChIKey: HZFFUMBZBGETES-UHFFFAOYSA-N.
| Molecular formula | C7H9BO4S |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | (3-methylsulfonylphenyl)boronic acid |
| InChIKey | HZFFUMBZBGETES-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)S(=O)(=O)C)(O)O |
Computed by PubChem (NCBI)