CAS 190788-58-0 appears in our catalog under these names: 4–Thioanisoleboronic acid, pinacol ester, 4,4,5,5-Tetramethyl-2-(4-(methylthio)phenyl)-1,3,2-dioxaborolane, 98%, 98%, 4,4,5,5-Tetramethyl-2-(4-(methylthio)phenyl)-1,3,2-dioxaborolane, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 250mg, 1g, 25g, 100g.
4,4,5,5-tetramethyl-2-(4-methylsulfanylphenyl)-1,3,2-dioxaborolane (CAS 190788-58-0) is a chemical compound with the molecular formula C13H19BO2S and a molecular weight of 250.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-methylsulfanylphenyl)-1,3,2-dioxaborolane. InChIKey: QECMXXYJBBIFRJ-UHFFFAOYSA-N.
| Molecular formula | C13H19BO2S |
|---|---|
| Molecular weight | 250.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-methylsulfanylphenyl)-1,3,2-dioxaborolane |
| InChIKey | QECMXXYJBBIFRJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)SC |
Computed by PubChem (NCBI)