CAS 2223033-79-0 appears in our catalog under these names: 3–Cyclopropylthiophene–2–boronic acid pinacol ester, 3-Cyclopropylthiophene-2-boronic acid pinacol ester. Offered by: GLPBio, Biosynth. Available pack sizes: 25mg, 5mg, 50mg, 0,5g.
2-(3-cyclopropylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2223033-79-0) is a chemical compound with the molecular formula C13H19BO2S and a molecular weight of 250.2 g/mol. IUPAC name: 2-(3-cyclopropylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: UUGGEKVAYXXDAY-UHFFFAOYSA-N.
| Molecular formula | C13H19BO2S |
|---|---|
| Molecular weight | 250.2 g/mol |
| IUPAC name | 2-(3-cyclopropylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | UUGGEKVAYXXDAY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CS2)C3CC3 |
Computed by PubChem (NCBI)