3-(N,N-Dimethylamino)phenylboronic acid hydrochloride, 95%
cas: 1256355-23-3 — see every product listed under this CAS number, including other names
3-(N,N-Dimethylamino)phenylboronic acid hydrochloride, 95% (CAS 1256355-23-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A113521-250mg |
| cas | 1256355-23-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 209.06 Pln | |
| Ambeed | 10g | 281.38 Pln | |
| Ambeed | 25g | 492.75 Pln | |
| Ambeed | 100g | 1738.75 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 219.95 Pln | |
| BLDpharm | 10g | 297.70 Pln | |
| BLDpharm | 25g | 525.40 Pln | |
| BLDpharm | 100g | 1869.37 Pln | |
| Fluorochem | 5g | 211.40 Pln | |
| Fluorochem | 10g | 294.71 Pln | |
| Fluorochem | 25g | 508.17 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
[3-(dimethylamino)phenyl]boronic acid;hydrochloride (CAS 1256355-23-3) is a chemical compound with the molecular formula C8H13BClNO2 and a molecular weight of 201.46 g/mol. IUPAC name: [3-(dimethylamino)phenyl]boronic acid;hydrochloride. InChIKey: QDYZZIRCCVRLBI-UHFFFAOYSA-N.
| Molecular formula | C8H13BClNO2 |
|---|---|
| Molecular weight | 201.46 g/mol |
| IUPAC name | [3-(dimethylamino)phenyl]boronic acid;hydrochloride |
| InChIKey | QDYZZIRCCVRLBI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)N(C)C)(O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
3-(N,N-Dimethylamino)phenylboronic acid hydrochloride, 3-(Dimethylamino)phenylboronic Acid Hydrochloride, (3-(Dimethylamino)phenyl)boronic acid hydrochloride, 3-Dimethylaminophenylboronic acid, HCl, [3-(dimethylamino)phenyl]boronic acid;hydrochloride, [3-(dimethylamino)phenyl]boronic acid hydrochloride, 3-(N,N-Dimethylamino)phenylboronic acidhydrochloride, [3-(Dimethylamino)phenyl]boronic acid--hydrogen chloride (1/1), 3-(Dimethylamino)benzeneboronic Acid Hydrochloride, 3-(N,N-Dimethylamino)phenylboronicacidhydrochloride