CAS 2377608-10-9 appears in our catalog under these names: [4-(Aminomethyl)-2-methylphenyl]boronic acid hydrochloride, 96%, (4-(Aminomethyl)-2-methylphenyl)boronic acid hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
[4-(aminomethyl)-2-methylphenyl]boronic acid;hydrochloride (CAS 2377608-10-9) is a chemical compound with the molecular formula C8H13BClNO2 and a molecular weight of 201.46 g/mol. IUPAC name: [4-(aminomethyl)-2-methylphenyl]boronic acid;hydrochloride. InChIKey: YZOYEEURZCCMMU-UHFFFAOYSA-N.
| Molecular formula | C8H13BClNO2 |
|---|---|
| Molecular weight | 201.46 g/mol |
| IUPAC name | [4-(aminomethyl)-2-methylphenyl]boronic acid;hydrochloride |
| InChIKey | YZOYEEURZCCMMU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)CN)C)(O)O.Cl |
Computed by PubChem (NCBI)