CAS 1150114-73-0 appears in our catalog under these names: 4-(Dimethylamino)phenylboronic acid hydrochloride, 98%, 4–(N,N–DiMethylaMino)Phenylboronic Acid Hydrochloride, 4-(N,N-Dimethylamino)Phenylboronic Acid Hydrochloride 98%, 4-(N,N-DiMethylaMino)Phenylboronic Acid Hydrochloride, 98%, 98%, (4-(Dimethylamino)phenyl)boronic acid hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 100g.
[4-(dimethylamino)phenyl]boronic acid;hydrochloride (CAS 1150114-73-0) is a chemical compound with the molecular formula C8H13BClNO2 and a molecular weight of 201.46 g/mol. IUPAC name: [4-(dimethylamino)phenyl]boronic acid;hydrochloride. InChIKey: JZMHULQJOBVQRI-UHFFFAOYSA-N.
| Molecular formula | C8H13BClNO2 |
|---|---|
| Molecular weight | 201.46 g/mol |
| IUPAC name | [4-(dimethylamino)phenyl]boronic acid;hydrochloride |
| InChIKey | JZMHULQJOBVQRI-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N(C)C)(O)O.Cl |
Computed by PubChem (NCBI)