CAS 2304634-16-8 appears in our catalog under these names: 4-[(methylamino)methyl]phenylboronic acid hydrochloride, 98%, (4-((Methylamino)methyl)phenyl)boronic acid hydrochloride, 98%, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
[4-(methylaminomethyl)phenyl]boronic acid;hydrochloride (CAS 2304634-16-8) is a chemical compound with the molecular formula C8H13BClNO2 and a molecular weight of 201.46 g/mol. IUPAC name: [4-(methylaminomethyl)phenyl]boronic acid;hydrochloride. InChIKey: XJUTYVLOIWUMQT-UHFFFAOYSA-N.
| Molecular formula | C8H13BClNO2 |
|---|---|
| Molecular weight | 201.46 g/mol |
| IUPAC name | [4-(methylaminomethyl)phenyl]boronic acid;hydrochloride |
| InChIKey | XJUTYVLOIWUMQT-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CNC)(O)O.Cl |
Computed by PubChem (NCBI)